C22H30F3N3O4 — CID 175186717
tert-butyl 4-[[3-[(2S)-pyrrolidine-2-carbonyl]oxy-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate (PubChem CID 175186717) has the molecular formula C22H30F3N3O4 and a molecular weight of 457.49 g/mol. Its IUPAC name is tert-butyl 4-[[3-[(2S)-pyrrolidine-2-carbonyl]oxy-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[3-[(2S)-pyrrolidine-2-carbonyl]oxy-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 175186717 |
| Molecular Formula | C22H30F3N3O4 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | tert-butyl 4-[[3-[(2S)-pyrrolidine-2-carbonyl]oxy-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2ccc(C(F)(F)F)c(OC(=O)[C@@H]3CCCN3)c2)CC1 |
| InChI | InChI=1S/C22H30F3N3O4/c1-21(2,3)32-20(30)28-11-9-27(10-12-28)14-15-6-7-16(22(23,24)25)18(13-15)31-19(29)17-5-4-8-26-17/h6-7,13,17,26H,4-5,8-12,14H2,1-3H3/t17-/m0/s1 |
| InChIKey | RNIOPUHXEUUKEJ-KRWDZBQOSA-N |
| XLogP | 3.42 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|