C13H21BO3 — CID 175193436
5-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopentene-1-carbaldehyde (PubChem CID 175193436) has the molecular formula C13H21BO3 and a molecular weight of 236.12 g/mol. Its IUPAC name is 5-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopentene-1-carbaldehyde.
| Compound Name | 5-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopentene-1-carbaldehyde |
|---|---|
| PubChem CID | 175193436 |
| Molecular Formula | C13H21BO3 |
| Molecular Weight | 236.12 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 5-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopentene-1-carbaldehyde |
| SMILES | CC1CCC(B2OC(C)(C)C(C)(C)O2)=C1C=O |
| InChI | InChI=1S/C13H21BO3/c1-9-6-7-11(10(9)8-15)14-16-12(2,3)13(4,5)17-14/h8-9H,6-7H2,1-5H3 |
| InChIKey | RURDRMNKTLOGCH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.12 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|