C14H19NO7P2S — CID 175199651
N-(2-dihydroxyphosphinothioyloxyethyl)-N-phenylaniline;phosphoric acid (PubChem CID 175199651) has the molecular formula C14H19NO7P2S and a molecular weight of 407.32 g/mol. Its IUPAC name is N-(2-dihydroxyphosphinothioyloxyethyl)-N-phenylaniline;phosphoric acid.
| Compound Name | N-(2-dihydroxyphosphinothioyloxyethyl)-N-phenylaniline;phosphoric acid |
|---|---|
| PubChem CID | 175199651 |
| Molecular Formula | C14H19NO7P2S |
| Molecular Weight | 407.32 g/mol |
| Exact Mass | 407.04 |
| IUPAC Name | N-(2-dihydroxyphosphinothioyloxyethyl)-N-phenylaniline;phosphoric acid |
| SMILES | O=P(O)(O)O.OP(O)(=S)OCCN(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H16NO3PS.H3O4P/c16-19(17,20)18-12-11-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14;1-5(2,3)4/h1-10H,11-12H2,(H2,16,17,20);(H3,1,2,3,4) |
| InChIKey | PQAXWNNPDOZWSD-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 130.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|