C31H42N6O6Si — CID 175202400
methyl 3-(5-hydroxypentyl)-2-[[2-methyl-6-[1-methyl-5-(2-trimethylsilylethoxymethoxy)pyrazol-4-yl]pyridine-4-carbonyl]amino]benzimidazole-5-carboxylate (PubChem CID 175202400) has the molecular formula C31H42N6O6Si and a molecular weight of 622.80 g/mol. Its IUPAC name is methyl 3-(5-hydroxypentyl)-2-[[2-methyl-6-[1-methyl-5-(2-trimethylsilylethoxymethoxy)pyrazol-4-yl]pyridine-4-carbonyl]amino]benzimidazole-5-carboxylate.
| Compound Name | methyl 3-(5-hydroxypentyl)-2-[[2-methyl-6-[1-methyl-5-(2-trimethylsilylethoxymethoxy)pyrazol-4-yl]pyridine-4-carbonyl]amino]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 175202400 |
| Molecular Formula | C31H42N6O6Si |
| Molecular Weight | 622.80 g/mol |
| Exact Mass | 622.29 |
| IUPAC Name | methyl 3-(5-hydroxypentyl)-2-[[2-methyl-6-[1-methyl-5-(2-trimethylsilylethoxymethoxy)pyrazol-4-yl]pyridine-4-carbonyl]amino]benzimidazole-5-carboxylate |
| SMILES | COC(=O)c1ccc2nc(NC(=O)c3cc(C)nc(-c4cnn(C)c4OCOCC[Si](C)(C)C)c3)n(CCCCCO)c2c1 |
| InChI | InChI=1S/C31H42N6O6Si/c1-21-16-23(17-26(33-21)24-19-32-36(2)29(24)43-20-42-14-15-44(4,5)6)28(39)35-31-34-25-11-10-22(30(40)41-3)18-27(25)37(31)12-8-7-9-13-38/h10-11,16-19,38H,7-9,12-15,20H2,1-6H3,(H,34,35,39) |
| InChIKey | AHUNXUMHIPVGAD-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 142.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.80 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|