About [3-(4-phenylphenyl)pyrazolo[4,3-c]pyridin-1-yl] cyclohexanecarboxylate
[3-(4-phenylphenyl)pyrazolo[4,3-c]pyridin-1-yl] cyclohexanecarboxylate (PubChem CID 175205886) has the molecular formula C25H23N3O2
and a molecular weight of 397.48 g/mol. Its IUPAC name is [3-(4-phenylphenyl)pyrazolo[4,3-c]pyridin-1-yl] cyclohexanecarboxylate.
Molecular Properties
| Compound Name | [3-(4-phenylphenyl)pyrazolo[4,3-c]pyridin-1-yl] cyclohexanecarboxylate |
| PubChem CID | 175205886 |
| Molecular Formula | C25H23N3O2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | [3-(4-phenylphenyl)pyrazolo[4,3-c]pyridin-1-yl] cyclohexanecarboxylate |
| SMILES | O=C(On1nc(-c2ccc(-c3ccccc3)cc2)c2cnccc21)C1CCCCC1 |
| InChI | InChI=1S/C25H23N3O2/c29-25(21-9-5-2-6-10-21)30-28-23-15-16-26-17-22(23)24(27-28)20-13-11-19(12-14-20)18-7-3-1-4-8-18/h1,3-4,7-8,11-17,21H,2,5-6,9-10H2 |
| InChIKey | XAKWOVRAHJEQLX-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-(4-phenylphenyl)pyrazolo[4,3-c]pyridin-1-yl] cyclohexanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-phenylphenyl)pyrazolo[4,3-c]pyridin-1-yl] cyclohexanecarboxylate?
The IUPAC name of [3-(4-phenylphenyl)pyrazolo[4,3-c]pyridin-1-yl] cyclohexanecarboxylate (CID 175205886) is [3-(4-phenylphenyl)pyrazolo[4,3-c]pyridin-1-yl] cyclohexanecarboxylate.
What is the SMILES notation for [3-(4-phenylphenyl)pyrazolo[4,3-c]pyridin-1-yl] cyclohexanecarboxylate?
The canonical SMILES for [3-(4-phenylphenyl)pyrazolo[4,3-c]pyridin-1-yl] cyclohexanecarboxylate is O=C(On1nc(-c2ccc(-c3ccccc3)cc2)c2cnccc21)C1CCCCC1.
What is the InChIKey of [3-(4-phenylphenyl)pyrazolo[4,3-c]pyridin-1-yl] cyclohexanecarboxylate?
The InChIKey is XAKWOVRAHJEQLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23N3O2/c29-25(21-9-5-2-6-10-21)30-28-23-15-16-26-17-22(23)24(27-28)20-13-11-19(12-14-20)18-7-3-1-4-8-18/h1,3-4,7-8,11-17,21H,2,5-6,9-10H2.
What are the key properties of [3-(4-phenylphenyl)pyrazolo[4,3-c]pyridin-1-yl] cyclohexanecarboxylate?
[3-(4-phenylphenyl)pyrazolo[4,3-c]pyridin-1-yl] cyclohexanecarboxylate has a molecular weight of 397.48 g/mol, XLogP of 5.30, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-phenylphenyl)pyrazolo[4,3-c]pyridin-1-yl] cyclohexanecarboxylate is sourced from PubChem (CID 175205886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).