About pyrazine-2-carbonyl pyridazine-4-carboxylate
pyrazine-2-carbonyl pyridazine-4-carboxylate (PubChem CID 175205992) has the molecular formula C10H6N4O3
and a molecular weight of 230.18 g/mol. Its IUPAC name is pyrazine-2-carbonyl pyridazine-4-carboxylate.
Molecular Properties
| Compound Name | pyrazine-2-carbonyl pyridazine-4-carboxylate |
| PubChem CID | 175205992 |
| Molecular Formula | C10H6N4O3 |
| Molecular Weight | 230.18 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | pyrazine-2-carbonyl pyridazine-4-carboxylate |
| SMILES | O=C(OC(=O)c1cnccn1)c1ccnnc1 |
| InChI | InChI=1S/C10H6N4O3/c15-9(7-1-2-13-14-5-7)17-10(16)8-6-11-3-4-12-8/h1-6H |
| InChIKey | HXGLPOZMYITOLV-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 94.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.18 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze pyrazine-2-carbonyl pyridazine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrazine-2-carbonyl pyridazine-4-carboxylate?
The IUPAC name of pyrazine-2-carbonyl pyridazine-4-carboxylate (CID 175205992) is pyrazine-2-carbonyl pyridazine-4-carboxylate.
What is the SMILES notation for pyrazine-2-carbonyl pyridazine-4-carboxylate?
The canonical SMILES for pyrazine-2-carbonyl pyridazine-4-carboxylate is O=C(OC(=O)c1cnccn1)c1ccnnc1.
What is the InChIKey of pyrazine-2-carbonyl pyridazine-4-carboxylate?
The InChIKey is HXGLPOZMYITOLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6N4O3/c15-9(7-1-2-13-14-5-7)17-10(16)8-6-11-3-4-12-8/h1-6H.
What are the key properties of pyrazine-2-carbonyl pyridazine-4-carboxylate?
pyrazine-2-carbonyl pyridazine-4-carboxylate has a molecular weight of 230.18 g/mol, XLogP of 0.26, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for pyrazine-2-carbonyl pyridazine-4-carboxylate is sourced from PubChem (CID 175205992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).