C25H19N3O10S — CID 175211653
5-[[(2R)-2-(4-nitrophenyl)sulfonyloxy-3-phenylpropanoyl]amino]indole-1,2-dicarboxylic acid (PubChem CID 175211653) has the molecular formula C25H19N3O10S and a molecular weight of 553.51 g/mol. Its IUPAC name is 5-[[(2R)-2-(4-nitrophenyl)sulfonyloxy-3-phenylpropanoyl]amino]indole-1,2-dicarboxylic acid.
| Compound Name | 5-[[(2R)-2-(4-nitrophenyl)sulfonyloxy-3-phenylpropanoyl]amino]indole-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 175211653 |
| Molecular Formula | C25H19N3O10S |
| Molecular Weight | 553.51 g/mol |
| Exact Mass | 553.08 |
| IUPAC Name | 5-[[(2R)-2-(4-nitrophenyl)sulfonyloxy-3-phenylpropanoyl]amino]indole-1,2-dicarboxylic acid |
| SMILES | O=C(O)c1cc2cc(NC(=O)[C@@H](Cc3ccccc3)OS(=O)(=O)c3ccc([N+](=O)[O-])cc3)ccc2n1C(=O)O |
| InChI | InChI=1S/C25H19N3O10S/c29-23(26-17-6-11-20-16(13-17)14-21(24(30)31)27(20)25(32)33)22(12-15-4-2-1-3-5-15)38-39(36,37)19-9-7-18(8-10-19)28(34)35/h1-11,13-14,22H,12H2,(H,26,29)(H,30,31)(H,32,33)/t22-/m1/s1 |
| InChIKey | MVDIRLMAYKRVKU-JOCHJYFZSA-N |
| XLogP | 3.73 |
| TPSA | 195.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|