C15H14F6 — CID 175218097
buta-1,3-diene;3,3,4,5,5,5-hexafluoropent-1-enylbenzene (PubChem CID 175218097) has the molecular formula C15H14F6 and a molecular weight of 308.27 g/mol. Its IUPAC name is buta-1,3-diene;3,3,4,5,5,5-hexafluoropent-1-enylbenzene.
| Compound Name | buta-1,3-diene;3,3,4,5,5,5-hexafluoropent-1-enylbenzene |
|---|---|
| PubChem CID | 175218097 |
| Molecular Formula | C15H14F6 |
| Molecular Weight | 308.27 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | buta-1,3-diene;3,3,4,5,5,5-hexafluoropent-1-enylbenzene |
| SMILES | C=CC=C.FC(C(F)(F)F)C(F)(F)C=Cc1ccccc1 |
| InChI | InChI=1S/C11H8F6.C4H6/c12-9(11(15,16)17)10(13,14)7-6-8-4-2-1-3-5-8;1-3-4-2/h1-7,9H;3-4H,1-2H2 |
| InChIKey | PEKWUQHTVAZKRN-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.27 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|