C13H20BF4N2- — CID 175221269
1-(1-adamantyl)-4,5-dihydroimidazole tetrafluoroborate (PubChem CID 175221269) has the molecular formula C13H20BF4N2- and a molecular weight of 291.12 g/mol. Its IUPAC name is 1-(1-adamantyl)-4,5-dihydroimidazole tetrafluoroborate.
| Compound Name | 1-(1-adamantyl)-4,5-dihydroimidazole tetrafluoroborate |
|---|---|
| PubChem CID | 175221269 |
| Molecular Formula | C13H20BF4N2- |
| Molecular Weight | 291.12 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 1-(1-adamantyl)-4,5-dihydroimidazole tetrafluoroborate |
| SMILES | C1=NCCN1C12CC3CC(CC(C3)C1)C2.F[B-](F)(F)F |
| InChI | InChI=1S/C13H20N2.BF4/c1-2-15(9-14-1)13-6-10-3-11(7-13)5-12(4-10)8-13;2-1(3,4)5/h9-12H,1-8H2;/q;-1 |
| InChIKey | FVVSUVGCKBAOJX-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.12 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|