C24H32N6 — CID 91440020
4-[3-[3-(1,2,4-triazol-4-yl)-1-adamantyl]-1-adamantyl]-1,2,4-triazole (PubChem CID 91440020) has the molecular formula C24H32N6 and a molecular weight of 404.56 g/mol. Its IUPAC name is 4-[3-[3-(1,2,4-triazol-4-yl)-1-adamantyl]-1-adamantyl]-1,2,4-triazole.
| Compound Name | 4-[3-[3-(1,2,4-triazol-4-yl)-1-adamantyl]-1-adamantyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 91440020 |
| Molecular Formula | C24H32N6 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | 4-[3-[3-(1,2,4-triazol-4-yl)-1-adamantyl]-1-adamantyl]-1,2,4-triazole |
| SMILES | c1nncn1C12CC3CC(C1)CC(C14CC5CC(CC(n6cnnc6)(C5)C1)C4)(C3)C2 |
| InChI | InChI=1S/C24H32N6/c1-17-3-21(4-18(1)8-23(7-17,11-21)29-13-25-26-14-29)22-5-19-2-20(6-22)10-24(9-19,12-22)30-15-27-28-16-30/h13-20H,1-12H2 |
| InChIKey | WWOKJPWRUCNLKT-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |