C39H52 — CID 175228501
2,7-ditert-butyl-9-[dicyclohexyl(cyclopenta-2,4-dien-1-yl)methyl]-9H-fluorene (PubChem CID 175228501) has the molecular formula C39H52 and a molecular weight of 520.85 g/mol. Its IUPAC name is 2,7-ditert-butyl-9-[dicyclohexyl(cyclopenta-2,4-dien-1-yl)methyl]-9H-fluorene.
| Compound Name | 2,7-ditert-butyl-9-[dicyclohexyl(cyclopenta-2,4-dien-1-yl)methyl]-9H-fluorene |
|---|---|
| PubChem CID | 175228501 |
| Molecular Formula | C39H52 |
| Molecular Weight | 520.85 g/mol |
| Exact Mass | 520.41 |
| IUPAC Name | 2,7-ditert-butyl-9-[dicyclohexyl(cyclopenta-2,4-dien-1-yl)methyl]-9H-fluorene |
| SMILES | CC(C)(C)c1ccc2c(c1)C(C(C1C=CC=C1)(C1CCCCC1)C1CCCCC1)c1cc(C(C)(C)C)ccc1-2 |
| InChI | InChI=1S/C39H52/c1-37(2,3)30-21-23-32-33-24-22-31(38(4,5)6)26-35(33)36(34(32)25-30)39(29-19-13-14-20-29,27-15-9-7-10-16-27)28-17-11-8-12-18-28/h13-14,19-29,36H,7-12,15-18H2,1-6H3 |
| InChIKey | RLMXNHWFPSCRSF-UHFFFAOYSA-N |
| XLogP | 11.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.85 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |