C9H7F2NO3 — CID 175233070
(3,6-difluoro-2-formylphenyl)methyl carbamate (PubChem CID 175233070) has the molecular formula C9H7F2NO3 and a molecular weight of 215.16 g/mol. Its IUPAC name is (3,6-difluoro-2-formylphenyl)methyl carbamate.
| Compound Name | (3,6-difluoro-2-formylphenyl)methyl carbamate |
|---|---|
| PubChem CID | 175233070 |
| Molecular Formula | C9H7F2NO3 |
| Molecular Weight | 215.16 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | (3,6-difluoro-2-formylphenyl)methyl carbamate |
| SMILES | NC(=O)OCc1c(F)ccc(F)c1C=O |
| InChI | InChI=1S/C9H7F2NO3/c10-7-1-2-8(11)6(5(7)3-13)4-15-9(12)14/h1-3H,4H2,(H2,12,14) |
| InChIKey | SKTFHQLYTMDZQU-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.16 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|