About 1-but-3-yn-2-ylimidazole tetrafluoroborate
1-but-3-yn-2-ylimidazole tetrafluoroborate (PubChem CID 175233094) has the molecular formula C7H8BF4N2-
and a molecular weight of 206.96 g/mol. Its IUPAC name is 1-but-3-yn-2-ylimidazole tetrafluoroborate.
Molecular Properties
| Compound Name | 1-but-3-yn-2-ylimidazole tetrafluoroborate |
| PubChem CID | 175233094 |
| Molecular Formula | C7H8BF4N2- |
| Molecular Weight | 206.96 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 1-but-3-yn-2-ylimidazole tetrafluoroborate |
| SMILES | C#CC(C)n1ccnc1.F[B-](F)(F)F |
| InChI | InChI=1S/C7H8N2.BF4/c1-3-7(2)9-5-4-8-6-9;2-1(3,4)5/h1,4-7H,2H3;/q;-1 |
| InChIKey | KZLCDNOFGVDJME-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.96 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-but-3-yn-2-ylimidazole tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-but-3-yn-2-ylimidazole tetrafluoroborate?
The IUPAC name of 1-but-3-yn-2-ylimidazole tetrafluoroborate (CID 175233094) is 1-but-3-yn-2-ylimidazole tetrafluoroborate.
What is the SMILES notation for 1-but-3-yn-2-ylimidazole tetrafluoroborate?
The canonical SMILES for 1-but-3-yn-2-ylimidazole tetrafluoroborate is C#CC(C)n1ccnc1.F[B-](F)(F)F.
What is the InChIKey of 1-but-3-yn-2-ylimidazole tetrafluoroborate?
The InChIKey is KZLCDNOFGVDJME-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2.BF4/c1-3-7(2)9-5-4-8-6-9;2-1(3,4)5/h1,4-7H,2H3;/q;-1.
What are the key properties of 1-but-3-yn-2-ylimidazole tetrafluoroborate?
1-but-3-yn-2-ylimidazole tetrafluoroborate has a molecular weight of 206.96 g/mol, XLogP of 2.38, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-but-3-yn-2-ylimidazole tetrafluoroborate is sourced from PubChem (CID 175233094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).