C19H16Cl3F3N4O2S — CID 175235017
N-[[2-(butylcarbamoyl)-4,6-dichlorophenyl]carbamothioyl]-3-chloro-5-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 175235017) has the molecular formula C19H16Cl3F3N4O2S and a molecular weight of 527.78 g/mol. Its IUPAC name is N-[[2-(butylcarbamoyl)-4,6-dichlorophenyl]carbamothioyl]-3-chloro-5-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | N-[[2-(butylcarbamoyl)-4,6-dichlorophenyl]carbamothioyl]-3-chloro-5-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 175235017 |
| Molecular Formula | C19H16Cl3F3N4O2S |
| Molecular Weight | 527.78 g/mol |
| Exact Mass | 526.00 |
| IUPAC Name | N-[[2-(butylcarbamoyl)-4,6-dichlorophenyl]carbamothioyl]-3-chloro-5-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | CCCCNC(=O)c1cc(Cl)cc(Cl)c1NC(=S)NC(=O)c1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C19H16Cl3F3N4O2S/c1-2-3-4-26-16(30)11-6-10(20)7-13(22)14(11)28-18(32)29-17(31)15-12(21)5-9(8-27-15)19(23,24)25/h5-8H,2-4H2,1H3,(H,26,30)(H2,28,29,31,32) |
| InChIKey | GNHRAWGNYZBUOQ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.78 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|