C31H31NOS — CID 175237424
1H-azepine;2-(4-methylsulfinylphenyl)-1,2,3,4,5,6-hexahydrochrysene (PubChem CID 175237424) has the molecular formula C31H31NOS and a molecular weight of 465.66 g/mol. Its IUPAC name is 1H-azepine;2-(4-methylsulfinylphenyl)-1,2,3,4,5,6-hexahydrochrysene.
| Compound Name | 1H-azepine;2-(4-methylsulfinylphenyl)-1,2,3,4,5,6-hexahydrochrysene |
|---|---|
| PubChem CID | 175237424 |
| Molecular Formula | C31H31NOS |
| Molecular Weight | 465.66 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | 1H-azepine;2-(4-methylsulfinylphenyl)-1,2,3,4,5,6-hexahydrochrysene |
| SMILES | C1=CC=CNC=C1.CS(=O)c1ccc(C2CCc3c(ccc4c3CCc3ccccc3-4)C2)cc1 |
| InChI | InChI=1S/C25H24OS.C6H7N/c1-27(26)21-11-6-17(7-12-21)19-9-13-23-20(16-19)10-15-24-22-5-3-2-4-18(22)8-14-25(23)24;1-2-4-6-7-5-3-1/h2-7,10-12,15,19H,8-9,13-14,16H2,1H3;1-7H |
| InChIKey | MYVOTLBUFGNMTL-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.66 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |