C24H23N3 — CID 174744492
2-methyl-1,2,3,4,5,6-hexahydrochrysene;pyrrolo[3,4-c]pyrazole (PubChem CID 174744492) has the molecular formula C24H23N3 and a molecular weight of 353.47 g/mol. Its IUPAC name is 2-methyl-1,2,3,4,5,6-hexahydrochrysene;pyrrolo[3,4-c]pyrazole.
| Compound Name | 2-methyl-1,2,3,4,5,6-hexahydrochrysene;pyrrolo[3,4-c]pyrazole |
|---|---|
| PubChem CID | 174744492 |
| Molecular Formula | C24H23N3 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 2-methyl-1,2,3,4,5,6-hexahydrochrysene;pyrrolo[3,4-c]pyrazole |
| SMILES | C1=NC=C2N=NC=C12.CC1CCc2c(ccc3c2CCc2ccccc2-3)C1 |
| InChI | InChI=1S/C19H20.C5H3N3/c1-13-6-9-17-15(12-13)8-11-18-16-5-3-2-4-14(16)7-10-19(17)18;1-4-2-7-8-5(4)3-6-1/h2-5,8,11,13H,6-7,9-10,12H2,1H3;1-3H |
| InChIKey | FREJCTGDQCSBHU-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |