C16H14N2O2S3 — CID 175238772
N-[4-[5-(sulfanylmethyl)-1,3-thiazol-4-yl]phenyl]benzenesulfonamide (PubChem CID 175238772) has the molecular formula C16H14N2O2S3 and a molecular weight of 362.50 g/mol. Its IUPAC name is N-[4-[5-(sulfanylmethyl)-1,3-thiazol-4-yl]phenyl]benzenesulfonamide.
| Compound Name | N-[4-[5-(sulfanylmethyl)-1,3-thiazol-4-yl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 175238772 |
| Molecular Formula | C16H14N2O2S3 |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | N-[4-[5-(sulfanylmethyl)-1,3-thiazol-4-yl]phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(-c2ncsc2CS)cc1)c1ccccc1 |
| InChI | InChI=1S/C16H14N2O2S3/c19-23(20,14-4-2-1-3-5-14)18-13-8-6-12(7-9-13)16-15(10-21)22-11-17-16/h1-9,11,18,21H,10H2 |
| InChIKey | KYHJCZCFPQUAOY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|