C20H19FN4O — CID 175246374
(4-fluorophenyl)-[(3S)-3-(1-pyridin-4-ylimidazol-4-yl)piperidin-1-yl]methanone (PubChem CID 175246374) has the molecular formula C20H19FN4O and a molecular weight of 350.40 g/mol. Its IUPAC name is (4-fluorophenyl)-[(3S)-3-(1-pyridin-4-ylimidazol-4-yl)piperidin-1-yl]methanone.
| Compound Name | (4-fluorophenyl)-[(3S)-3-(1-pyridin-4-ylimidazol-4-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 175246374 |
| Molecular Formula | C20H19FN4O |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | (4-fluorophenyl)-[(3S)-3-(1-pyridin-4-ylimidazol-4-yl)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(F)cc1)N1CCC[C@H](c2cn(-c3ccncc3)cn2)C1 |
| InChI | InChI=1S/C20H19FN4O/c21-17-5-3-15(4-6-17)20(26)24-11-1-2-16(12-24)19-13-25(14-23-19)18-7-9-22-10-8-18/h3-10,13-14,16H,1-2,11-12H2/t16-/m0/s1 |
| InChIKey | WRDRECNXRQSGBE-INIZCTEOSA-N |
| XLogP | 3.43 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |