C27H20FNO3S — CID 175250368
9H-fluoren-9-ylmethyl N-[[2-(2-fluoro-6-formylphenyl)thiophen-3-yl]methyl]carbamate (PubChem CID 175250368) has the molecular formula C27H20FNO3S and a molecular weight of 457.53 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[[2-(2-fluoro-6-formylphenyl)thiophen-3-yl]methyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[[2-(2-fluoro-6-formylphenyl)thiophen-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 175250368 |
| Molecular Formula | C27H20FNO3S |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[[2-(2-fluoro-6-formylphenyl)thiophen-3-yl]methyl]carbamate |
| SMILES | O=Cc1cccc(F)c1-c1sccc1CNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C27H20FNO3S/c28-24-11-5-6-18(15-30)25(24)26-17(12-13-33-26)14-29-27(31)32-16-23-21-9-3-1-7-19(21)20-8-2-4-10-22(20)23/h1-13,15,23H,14,16H2,(H,29,31) |
| InChIKey | VGANDUNUOPPCCU-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|