C30H21ClF3NO3S — CID 175543587
9H-fluoren-9-ylmethyl N-[[3-chloro-2-(2-formylphenyl)-4-sulfanyl-6-(trifluoromethyl)phenyl]methyl]carbamate (PubChem CID 175543587) has the molecular formula C30H21ClF3NO3S and a molecular weight of 568.02 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[[3-chloro-2-(2-formylphenyl)-4-sulfanyl-6-(trifluoromethyl)phenyl]methyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[[3-chloro-2-(2-formylphenyl)-4-sulfanyl-6-(trifluoromethyl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 175543587 |
| Molecular Formula | C30H21ClF3NO3S |
| Molecular Weight | 568.02 g/mol |
| Exact Mass | 567.09 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[[3-chloro-2-(2-formylphenyl)-4-sulfanyl-6-(trifluoromethyl)phenyl]methyl]carbamate |
| SMILES | O=Cc1ccccc1-c1c(Cl)c(S)cc(C(F)(F)F)c1CNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C30H21ClF3NO3S/c31-28-26(39)13-25(30(32,33)34)23(27(28)18-8-2-1-7-17(18)15-36)14-35-29(37)38-16-24-21-11-5-3-9-19(21)20-10-4-6-12-22(20)24/h1-13,15,24,39H,14,16H2,(H,35,37) |
| InChIKey | YFKSKWDOWTXLKI-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.02 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|