C29H20BrF3N2O3S — CID 129079178
9H-fluoren-9-ylmethyl N-[[5-bromo-2-[(3-formyl-2-pyridinyl)sulfanyl]-3-(trifluoromethyl)phenyl]methyl]carbamate (PubChem CID 129079178) has the molecular formula C29H20BrF3N2O3S and a molecular weight of 613.46 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[[5-bromo-2-[(3-formyl-2-pyridinyl)sulfanyl]-3-(trifluoromethyl)phenyl]methyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[[5-bromo-2-[(3-formyl-2-pyridinyl)sulfanyl]-3-(trifluoromethyl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 129079178 |
| Molecular Formula | C29H20BrF3N2O3S |
| Molecular Weight | 613.46 g/mol |
| Exact Mass | 612.03 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[[5-bromo-2-[(3-formyl-2-pyridinyl)sulfanyl]-3-(trifluoromethyl)phenyl]methyl]carbamate |
| SMILES | O=Cc1cccnc1Sc1c(CNC(=O)OCC2c3ccccc3-c3ccccc32)cc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C29H20BrF3N2O3S/c30-19-12-18(26(25(13-19)29(31,32)33)39-27-17(15-36)6-5-11-34-27)14-35-28(37)38-16-24-22-9-3-1-7-20(22)21-8-2-4-10-23(21)24/h1-13,15,24H,14,16H2,(H,35,37) |
| InChIKey | YQIOYMNOPKUTLC-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.46 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|