C33H23Cl2N3O3S — CID 129078947
9H-fluoren-9-ylmethyl N-[[3-chloro-5-(2-chloro-4-pyridinyl)-2-[(3-formyl-2-pyridinyl)sulfanyl]phenyl]methyl]carbamate (PubChem CID 129078947) has the molecular formula C33H23Cl2N3O3S and a molecular weight of 612.54 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[[3-chloro-5-(2-chloro-4-pyridinyl)-2-[(3-formyl-2-pyridinyl)sulfanyl]phenyl]methyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[[3-chloro-5-(2-chloro-4-pyridinyl)-2-[(3-formyl-2-pyridinyl)sulfanyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 129078947 |
| Molecular Formula | C33H23Cl2N3O3S |
| Molecular Weight | 612.54 g/mol |
| Exact Mass | 611.08 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[[3-chloro-5-(2-chloro-4-pyridinyl)-2-[(3-formyl-2-pyridinyl)sulfanyl]phenyl]methyl]carbamate |
| SMILES | O=Cc1cccnc1Sc1c(Cl)cc(-c2ccnc(Cl)c2)cc1CNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C33H23Cl2N3O3S/c34-29-15-22(20-11-13-36-30(35)16-20)14-23(31(29)42-32-21(18-39)6-5-12-37-32)17-38-33(40)41-19-28-26-9-3-1-7-24(26)25-8-2-4-10-27(25)28/h1-16,18,28H,17,19H2,(H,38,40) |
| InChIKey | QNTCNBRNUIFQPV-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.54 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|