C28H20F2N2O3S — CID 129079197
9H-fluoren-9-ylmethyl N-[[3,6-difluoro-2-[(3-formyl-2-pyridinyl)sulfanyl]phenyl]methyl]carbamate (PubChem CID 129079197) has the molecular formula C28H20F2N2O3S and a molecular weight of 502.54 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[[3,6-difluoro-2-[(3-formyl-2-pyridinyl)sulfanyl]phenyl]methyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[[3,6-difluoro-2-[(3-formyl-2-pyridinyl)sulfanyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 129079197 |
| Molecular Formula | C28H20F2N2O3S |
| Molecular Weight | 502.54 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[[3,6-difluoro-2-[(3-formyl-2-pyridinyl)sulfanyl]phenyl]methyl]carbamate |
| SMILES | O=Cc1cccnc1Sc1c(F)ccc(F)c1CNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C28H20F2N2O3S/c29-24-11-12-25(30)26(36-27-17(15-33)6-5-13-31-27)22(24)14-32-28(34)35-16-23-20-9-3-1-7-18(20)19-8-2-4-10-21(19)23/h1-13,15,23H,14,16H2,(H,32,34) |
| InChIKey | CPUBVXJRWUZBKJ-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.54 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|