C30H23ClN4O3S — CID 139549291
9H-fluoren-9-ylmethyl N-[[3-chloro-2-[(3-formyl-2-pyridinyl)sulfanyl]-5-(2-iminoethanimidoyl)phenyl]methyl]carbamate (PubChem CID 139549291) has the molecular formula C30H23ClN4O3S and a molecular weight of 555.06 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[[3-chloro-2-[(3-formyl-2-pyridinyl)sulfanyl]-5-(2-iminoethanimidoyl)phenyl]methyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[[3-chloro-2-[(3-formyl-2-pyridinyl)sulfanyl]-5-(2-iminoethanimidoyl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 139549291 |
| Molecular Formula | C30H23ClN4O3S |
| Molecular Weight | 555.06 g/mol |
| Exact Mass | 554.12 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[[3-chloro-2-[(3-formyl-2-pyridinyl)sulfanyl]-5-(2-iminoethanimidoyl)phenyl]methyl]carbamate |
| SMILES | [H]/N=C(\C=N\[H])c1cc(Cl)c(Sc2ncccc2C=O)c(CNC(=O)OCC2c3ccccc3-c3ccccc32)c1 |
| InChI | InChI=1S/C30H23ClN4O3S/c31-26-13-19(27(33)14-32)12-20(28(26)39-29-18(16-36)6-5-11-34-29)15-35-30(37)38-17-25-23-9-3-1-7-21(23)22-8-2-4-10-24(22)25/h1-14,16,25,32-33H,15,17H2,(H,35,37)/b32-14+,33-27+ |
| InChIKey | SPZOMQOXIMLBOO-MPDWYWPISA-N |
| XLogP | 6.75 |
| TPSA | 115.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.06 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|