C32H23ClN3O3S- — CID 145301734
9H-fluoren-9-ylmethyl N-[[3-chloro-2-[(3-formyl-2-pyridinyl)sulfanyl]-5-pyrrol-1-id-3-ylphenyl]methyl]carbamate (PubChem CID 145301734) has the molecular formula C32H23ClN3O3S- and a molecular weight of 565.07 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[[3-chloro-2-[(3-formyl-2-pyridinyl)sulfanyl]-5-pyrrol-1-id-3-ylphenyl]methyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[[3-chloro-2-[(3-formyl-2-pyridinyl)sulfanyl]-5-pyrrol-1-id-3-ylphenyl]methyl]carbamate |
|---|---|
| PubChem CID | 145301734 |
| Molecular Formula | C32H23ClN3O3S- |
| Molecular Weight | 565.07 g/mol |
| Exact Mass | 564.12 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[[3-chloro-2-[(3-formyl-2-pyridinyl)sulfanyl]-5-pyrrol-1-id-3-ylphenyl]methyl]carbamate |
| SMILES | O=Cc1cccnc1Sc1c(Cl)cc(-c2cc[n-]c2)cc1CNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C32H23ClN3O3S/c33-29-15-22(20-11-13-34-16-20)14-23(30(29)40-31-21(18-37)6-5-12-35-31)17-36-32(38)39-19-28-26-9-3-1-7-24(26)25-8-2-4-10-27(25)28/h1-16,18,28H,17,19H2,(H,36,38)/q-1 |
| InChIKey | BCADCANAXIQEEQ-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 82.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.07 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|