C29H23BrN2O3S — CID 129078988
9H-fluoren-9-ylmethyl N-[[5-bromo-2-[(3-formyl-2-pyridinyl)sulfanyl]-3-methylphenyl]methyl]carbamate (PubChem CID 129078988) has the molecular formula C29H23BrN2O3S and a molecular weight of 559.49 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[[5-bromo-2-[(3-formyl-2-pyridinyl)sulfanyl]-3-methylphenyl]methyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[[5-bromo-2-[(3-formyl-2-pyridinyl)sulfanyl]-3-methylphenyl]methyl]carbamate |
|---|---|
| PubChem CID | 129078988 |
| Molecular Formula | C29H23BrN2O3S |
| Molecular Weight | 559.49 g/mol |
| Exact Mass | 558.06 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[[5-bromo-2-[(3-formyl-2-pyridinyl)sulfanyl]-3-methylphenyl]methyl]carbamate |
| SMILES | Cc1cc(Br)cc(CNC(=O)OCC2c3ccccc3-c3ccccc32)c1Sc1ncccc1C=O |
| InChI | InChI=1S/C29H23BrN2O3S/c1-18-13-21(30)14-20(27(18)36-28-19(16-33)7-6-12-31-28)15-32-29(34)35-17-26-24-10-4-2-8-22(24)23-9-3-5-11-25(23)26/h2-14,16,26H,15,17H2,1H3,(H,32,34) |
| InChIKey | FGPHYPWYXMDFPG-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.49 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|