C33H31NO3S — CID 129078876
9H-fluoren-9-ylmethyl N-[[5-tert-butyl-2-(2-formylphenyl)sulfanylphenyl]methyl]carbamate (PubChem CID 129078876) has the molecular formula C33H31NO3S and a molecular weight of 521.68 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[[5-tert-butyl-2-(2-formylphenyl)sulfanylphenyl]methyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[[5-tert-butyl-2-(2-formylphenyl)sulfanylphenyl]methyl]carbamate |
|---|---|
| PubChem CID | 129078876 |
| Molecular Formula | C33H31NO3S |
| Molecular Weight | 521.68 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[[5-tert-butyl-2-(2-formylphenyl)sulfanylphenyl]methyl]carbamate |
| SMILES | CC(C)(C)c1ccc(Sc2ccccc2C=O)c(CNC(=O)OCC2c3ccccc3-c3ccccc32)c1 |
| InChI | InChI=1S/C33H31NO3S/c1-33(2,3)24-16-17-31(38-30-15-9-4-10-22(30)20-35)23(18-24)19-34-32(36)37-21-29-27-13-7-5-11-25(27)26-12-6-8-14-28(26)29/h4-18,20,29H,19,21H2,1-3H3,(H,34,36) |
| InChIKey | CGBHCHZPMBLCDD-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.68 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|