C12H30O9P+ — CID 175254643
bis(butane-1,1-diol);dihydroxy(oxo)phosphanium;methyl propanoate (PubChem CID 175254643) has the molecular formula C12H30O9P+ and a molecular weight of 349.34 g/mol. Its IUPAC name is bis(butane-1,1-diol);dihydroxy(oxo)phosphanium;methyl propanoate.
| Compound Name | bis(butane-1,1-diol);dihydroxy(oxo)phosphanium;methyl propanoate |
|---|---|
| PubChem CID | 175254643 |
| Molecular Formula | C12H30O9P+ |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | bis(butane-1,1-diol);dihydroxy(oxo)phosphanium;methyl propanoate |
| SMILES | CCC(=O)OC.CCCC(O)O.CCCC(O)O.O=[P+](O)O |
| InChI | InChI=1S/C4H8O2.2C4H10O2.HO3P/c1-3-4(5)6-2;2*1-2-3-4(5)6;1-4(2)3/h3H2,1-2H3;2*4-6H,2-3H2,1H3;(H-,1,2,3)/p+1 |
| InChIKey | GGMMSRPLKPHSDA-UHFFFAOYSA-O |
| XLogP | 0.39 |
| TPSA | 164.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|