C28H30N2O5S — CID 175256593
ethyl 2-[2-[[7-[3-(C-tert-butylsulfinylcarbonimidoyl)pyrrol-1-yl]-1-benzofuran-5-yl]methoxy]phenyl]acetate (PubChem CID 175256593) has the molecular formula C28H30N2O5S and a molecular weight of 506.62 g/mol. Its IUPAC name is ethyl 2-[2-[[7-[3-(C-tert-butylsulfinylcarbonimidoyl)pyrrol-1-yl]-1-benzofuran-5-yl]methoxy]phenyl]acetate.
| Compound Name | ethyl 2-[2-[[7-[3-(C-tert-butylsulfinylcarbonimidoyl)pyrrol-1-yl]-1-benzofuran-5-yl]methoxy]phenyl]acetate |
|---|---|
| PubChem CID | 175256593 |
| Molecular Formula | C28H30N2O5S |
| Molecular Weight | 506.62 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | ethyl 2-[2-[[7-[3-(C-tert-butylsulfinylcarbonimidoyl)pyrrol-1-yl]-1-benzofuran-5-yl]methoxy]phenyl]acetate |
| SMILES | [H]/N=C(/c1ccn(-c2cc(COc3ccccc3CC(=O)OCC)cc3ccoc23)c1)S(=O)C(C)(C)C |
| InChI | InChI=1S/C28H30N2O5S/c1-5-33-25(31)16-20-8-6-7-9-24(20)35-18-19-14-21-11-13-34-26(21)23(15-19)30-12-10-22(17-30)27(29)36(32)28(2,3)4/h6-15,17,29H,5,16,18H2,1-4H3/b29-27- |
| InChIKey | SCIHGNUHUFTJBF-OHYPFYFLSA-N |
| XLogP | 5.78 |
| TPSA | 94.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.62 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|