C5H5F3N2 — CID 175260687
1-(1,2,2-trifluoroethyl)pyrazole (PubChem CID 175260687) has the molecular formula C5H5F3N2 and a molecular weight of 150.10 g/mol. Its IUPAC name is 1-(1,2,2-trifluoroethyl)pyrazole.
| Compound Name | 1-(1,2,2-trifluoroethyl)pyrazole |
|---|---|
| PubChem CID | 175260687 |
| Molecular Formula | C5H5F3N2 |
| Molecular Weight | 150.10 g/mol |
| Exact Mass | 150.04 |
| IUPAC Name | 1-(1,2,2-trifluoroethyl)pyrazole |
| SMILES | FC(F)C(F)n1cccn1 |
| InChI | InChI=1S/C5H5F3N2/c6-4(7)5(8)10-3-1-2-9-10/h1-5H |
| InChIKey | XOOMLUVQEDADOT-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.10 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |