C19H23N7S2 — CID 175263686
6-amino-9-(1-amino-5-methylhexyl)-8-(1,3-benzothiazol-2-yl)-1H-purine-2-thione (PubChem CID 175263686) has the molecular formula C19H23N7S2 and a molecular weight of 413.58 g/mol. Its IUPAC name is 6-amino-9-(1-amino-5-methylhexyl)-8-(1,3-benzothiazol-2-yl)-1H-purine-2-thione.
| Compound Name | 6-amino-9-(1-amino-5-methylhexyl)-8-(1,3-benzothiazol-2-yl)-1H-purine-2-thione |
|---|---|
| PubChem CID | 175263686 |
| Molecular Formula | C19H23N7S2 |
| Molecular Weight | 413.58 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 6-amino-9-(1-amino-5-methylhexyl)-8-(1,3-benzothiazol-2-yl)-1H-purine-2-thione |
| SMILES | CC(C)CCCC(N)n1c(-c2nc3ccccc3s2)nc2c(N)[nH]c(=S)nc21 |
| InChI | InChI=1S/C19H23N7S2/c1-10(2)6-5-9-13(20)26-16-14(15(21)24-19(27)25-16)23-17(26)18-22-11-7-3-4-8-12(11)28-18/h3-4,7-8,10,13H,5-6,9,20H2,1-2H3,(H3,21,24,25,27) |
| InChIKey | PJXIILHLUFEGJY-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.58 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|