C16H11N3S3 — CID 888950
4-amino-5-(1,3-benzothiazol-2-yl)-3-phenyl-1,3-thiazole-2-thione (PubChem CID 888950) has the molecular formula C16H11N3S3 and a molecular weight of 341.49 g/mol. Its IUPAC name is 4-amino-5-(1,3-benzothiazol-2-yl)-3-phenyl-1,3-thiazole-2-thione.
| Compound Name | 4-amino-5-(1,3-benzothiazol-2-yl)-3-phenyl-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 888950 |
| Molecular Formula | C16H11N3S3 |
| Molecular Weight | 341.49 g/mol |
| Exact Mass | 341.01 |
| IUPAC Name | 4-amino-5-(1,3-benzothiazol-2-yl)-3-phenyl-1,3-thiazole-2-thione |
| SMILES | Nc1c(-c2nc3ccccc3s2)sc(=S)n1-c1ccccc1 |
| InChI | InChI=1S/C16H11N3S3/c17-14-13(15-18-11-8-4-5-9-12(11)21-15)22-16(20)19(14)10-6-2-1-3-7-10/h1-9H,17H2 |
| InChIKey | IFQVNAUKVQSMPU-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.49 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|