C11H9FN2O3 — CID 175264938
[1-fluoro-2-(4-oxo-3H-quinazolin-2-yl)ethyl] formate (PubChem CID 175264938) has the molecular formula C11H9FN2O3 and a molecular weight of 236.20 g/mol. Its IUPAC name is [1-fluoro-2-(4-oxo-3H-quinazolin-2-yl)ethyl] formate.
| Compound Name | [1-fluoro-2-(4-oxo-3H-quinazolin-2-yl)ethyl] formate |
|---|---|
| PubChem CID | 175264938 |
| Molecular Formula | C11H9FN2O3 |
| Molecular Weight | 236.20 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | [1-fluoro-2-(4-oxo-3H-quinazolin-2-yl)ethyl] formate |
| SMILES | O=COC(F)Cc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C11H9FN2O3/c12-9(17-6-15)5-10-13-8-4-2-1-3-7(8)11(16)14-10/h1-4,6,9H,5H2,(H,13,14,16) |
| InChIKey | IJIWMOYQFQKAKE-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.20 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|