C19H25N7O6S — CID 175270030
2-[(1R,2R,3R,4S)-2,3-dihydroxy-4-[7-[(4-methylphenyl)methylamino]triazolo[4,5-d]pyrimidin-3-yl]cyclopentyl]oxyethyl sulfamate (PubChem CID 175270030) has the molecular formula C19H25N7O6S and a molecular weight of 479.52 g/mol. Its IUPAC name is 2-[(1R,2R,3R,4S)-2,3-dihydroxy-4-[7-[(4-methylphenyl)methylamino]triazolo[4,5-d]pyrimidin-3-yl]cyclopentyl]oxyethyl sulfamate.
| Compound Name | 2-[(1R,2R,3R,4S)-2,3-dihydroxy-4-[7-[(4-methylphenyl)methylamino]triazolo[4,5-d]pyrimidin-3-yl]cyclopentyl]oxyethyl sulfamate |
|---|---|
| PubChem CID | 175270030 |
| Molecular Formula | C19H25N7O6S |
| Molecular Weight | 479.52 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 2-[(1R,2R,3R,4S)-2,3-dihydroxy-4-[7-[(4-methylphenyl)methylamino]triazolo[4,5-d]pyrimidin-3-yl]cyclopentyl]oxyethyl sulfamate |
| SMILES | Cc1ccc(CNc2ncnc3c2nnn3[C@H]2C[C@@H](OCCOS(N)(=O)=O)[C@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C19H25N7O6S/c1-11-2-4-12(5-3-11)9-21-18-15-19(23-10-22-18)26(25-24-15)13-8-14(17(28)16(13)27)31-6-7-32-33(20,29)30/h2-5,10,13-14,16-17,27-28H,6-9H2,1H3,(H2,20,29,30)(H,21,22,23)/t13-,14+,16+,17-/m0/s1 |
| InChIKey | VHURNVQXVDUKCD-ABFRBSLYSA-N |
| XLogP | -0.59 |
| TPSA | 187.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.52 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|