C19H22ClN5O5S — CID 88548372
[(1S,2R,3S)-1-[4-[(4-chlorophenyl)methylamino]pyrrolo[2,3-d]pyrimidin-7-yl]-2,3-dihydroxycyclopentyl]methyl sulfamate (PubChem CID 88548372) has the molecular formula C19H22ClN5O5S and a molecular weight of 467.94 g/mol. Its IUPAC name is [(1S,2R,3S)-1-[4-[(4-chlorophenyl)methylamino]pyrrolo[2,3-d]pyrimidin-7-yl]-2,3-dihydroxycyclopentyl]methyl sulfamate.
| Compound Name | [(1S,2R,3S)-1-[4-[(4-chlorophenyl)methylamino]pyrrolo[2,3-d]pyrimidin-7-yl]-2,3-dihydroxycyclopentyl]methyl sulfamate |
|---|---|
| PubChem CID | 88548372 |
| Molecular Formula | C19H22ClN5O5S |
| Molecular Weight | 467.94 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | [(1S,2R,3S)-1-[4-[(4-chlorophenyl)methylamino]pyrrolo[2,3-d]pyrimidin-7-yl]-2,3-dihydroxycyclopentyl]methyl sulfamate |
| SMILES | NS(=O)(=O)OC[C@@]1(n2ccc3c(NCc4ccc(Cl)cc4)ncnc32)CC[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H22ClN5O5S/c20-13-3-1-12(2-4-13)9-22-17-14-6-8-25(18(14)24-11-23-17)19(10-30-31(21,28)29)7-5-15(26)16(19)27/h1-4,6,8,11,15-16,26-27H,5,7,9-10H2,(H2,21,28,29)(H,22,23,24)/t15-,16-,19-/m0/s1 |
| InChIKey | JPMJDMZIOHMECQ-BXWFABGCSA-N |
| XLogP | 1.13 |
| TPSA | 152.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.94 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |