C18H19ClN4O6S2 — CID 88575196
[(2R,3S,4R)-5-[4-[(4-chlorophenyl)methylamino]thieno[3,2-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methyl sulfamate (PubChem CID 88575196) has the molecular formula C18H19ClN4O6S2 and a molecular weight of 486.96 g/mol. Its IUPAC name is [(2R,3S,4R)-5-[4-[(4-chlorophenyl)methylamino]thieno[3,2-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methyl sulfamate.
| Compound Name | [(2R,3S,4R)-5-[4-[(4-chlorophenyl)methylamino]thieno[3,2-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methyl sulfamate |
|---|---|
| PubChem CID | 88575196 |
| Molecular Formula | C18H19ClN4O6S2 |
| Molecular Weight | 486.96 g/mol |
| Exact Mass | 486.04 |
| IUPAC Name | [(2R,3S,4R)-5-[4-[(4-chlorophenyl)methylamino]thieno[3,2-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methyl sulfamate |
| SMILES | NS(=O)(=O)OC[C@H]1OC(c2csc3c(NCc4ccc(Cl)cc4)ncnc23)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H19ClN4O6S2/c19-10-3-1-9(2-4-10)5-21-18-17-13(22-8-23-18)11(7-30-17)16-15(25)14(24)12(29-16)6-28-31(20,26)27/h1-4,7-8,12,14-16,24-25H,5-6H2,(H2,20,26,27)(H,21,22,23)/t12-,14-,15-,16?/m1/s1 |
| InChIKey | LVIMDRZYHVGRIL-KCMBKRDQSA-N |
| XLogP | 1.34 |
| TPSA | 156.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.96 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |