C26H33FO5S2 — CID 175270843
(Z)-3-[(3-butyl-7-ethylsulfanyl-1,1-dihydroxy-2-methyl-5-phenyl-2,3,4,5-tetrahydro-1λ4-benzothiepin-8-yl)oxy]-2-fluoroprop-2-enoic acid (PubChem CID 175270843) has the molecular formula C26H33FO5S2 and a molecular weight of 508.68 g/mol. Its IUPAC name is (Z)-3-[(3-butyl-7-ethylsulfanyl-1,1-dihydroxy-2-methyl-5-phenyl-2,3,4,5-tetrahydro-1λ4-benzothiepin-8-yl)oxy]-2-fluoroprop-2-enoic acid.
| Compound Name | (Z)-3-[(3-butyl-7-ethylsulfanyl-1,1-dihydroxy-2-methyl-5-phenyl-2,3,4,5-tetrahydro-1λ4-benzothiepin-8-yl)oxy]-2-fluoroprop-2-enoic acid |
|---|---|
| PubChem CID | 175270843 |
| Molecular Formula | C26H33FO5S2 |
| Molecular Weight | 508.68 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | (Z)-3-[(3-butyl-7-ethylsulfanyl-1,1-dihydroxy-2-methyl-5-phenyl-2,3,4,5-tetrahydro-1λ4-benzothiepin-8-yl)oxy]-2-fluoroprop-2-enoic acid |
| SMILES | CCCCC1CC(c2ccccc2)c2cc(SCC)c(O/C=C(\F)C(=O)O)cc2S(O)(O)C1C |
| InChI | InChI=1S/C26H33FO5S2/c1-4-6-10-19-13-20(18-11-8-7-9-12-18)21-14-24(33-5-2)23(32-16-22(27)26(28)29)15-25(21)34(30,31)17(19)3/h7-9,11-12,14-17,19-20,30-31H,4-6,10,13H2,1-3H3,(H,28,29)/b22-16- |
| InChIKey | ZPQKMKRVKSHHSU-JWGURIENSA-N |
| XLogP | 7.91 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.68 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|