C28H39NO5S2 — CID 175484348
tert-butyl (E)-3-[(3-butyl-7-ethylsulfanyl-1,1-dihydroxy-5-phenyl-2,3,4,5-tetrahydro-1λ4,2-benzothiazepin-8-yl)oxy]prop-2-enoate (PubChem CID 175484348) has the molecular formula C28H39NO5S2 and a molecular weight of 533.76 g/mol. Its IUPAC name is tert-butyl (E)-3-[(3-butyl-7-ethylsulfanyl-1,1-dihydroxy-5-phenyl-2,3,4,5-tetrahydro-1λ4,2-benzothiazepin-8-yl)oxy]prop-2-enoate.
| Compound Name | tert-butyl (E)-3-[(3-butyl-7-ethylsulfanyl-1,1-dihydroxy-5-phenyl-2,3,4,5-tetrahydro-1λ4,2-benzothiazepin-8-yl)oxy]prop-2-enoate |
|---|---|
| PubChem CID | 175484348 |
| Molecular Formula | C28H39NO5S2 |
| Molecular Weight | 533.76 g/mol |
| Exact Mass | 533.23 |
| IUPAC Name | tert-butyl (E)-3-[(3-butyl-7-ethylsulfanyl-1,1-dihydroxy-5-phenyl-2,3,4,5-tetrahydro-1λ4,2-benzothiazepin-8-yl)oxy]prop-2-enoate |
| SMILES | CCCCC1CC(c2ccccc2)c2cc(SCC)c(O/C=C/C(=O)OC(C)(C)C)cc2S(O)(O)N1 |
| InChI | InChI=1S/C28H39NO5S2/c1-6-8-14-21-17-22(20-12-10-9-11-13-20)23-18-25(35-7-2)24(19-26(23)36(31,32)29-21)33-16-15-27(30)34-28(3,4)5/h9-13,15-16,18-19,21-22,29,31-32H,6-8,14,17H2,1-5H3/b16-15+ |
| InChIKey | XNWVBXJMMTYGSU-FOCLMDBBSA-N |
| XLogP | 7.74 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.76 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|