C9H17N3O3 — CID 175278143
[4-methyl-1-(methylcarbamoyl)piperidin-4-yl] carbamate (PubChem CID 175278143) has the molecular formula C9H17N3O3 and a molecular weight of 215.25 g/mol. Its IUPAC name is [4-methyl-1-(methylcarbamoyl)piperidin-4-yl] carbamate.
| Compound Name | [4-methyl-1-(methylcarbamoyl)piperidin-4-yl] carbamate |
|---|---|
| PubChem CID | 175278143 |
| Molecular Formula | C9H17N3O3 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | [4-methyl-1-(methylcarbamoyl)piperidin-4-yl] carbamate |
| SMILES | CNC(=O)N1CCC(C)(OC(N)=O)CC1 |
| InChI | InChI=1S/C9H17N3O3/c1-9(15-7(10)13)3-5-12(6-4-9)8(14)11-2/h3-6H2,1-2H3,(H2,10,13)(H,11,14) |
| InChIKey | GWMCQAQHXVNKQA-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |