About azane;2-pentylporphyrin
azane;2-pentylporphyrin (PubChem CID 175279490) has the molecular formula C25H25N5
and a molecular weight of 395.51 g/mol. Its IUPAC name is azane;2-pentylporphyrin.
Molecular Properties
| Compound Name | azane;2-pentylporphyrin |
| PubChem CID | 175279490 |
| Molecular Formula | C25H25N5 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | azane;2-pentylporphyrin |
| SMILES | CCCCCC1=CC2=N/C1=C\C1=N/C(=C\C3=N/C(=C\C4=N/C(=C\2)C=C4)C=C3)C=C1.N |
| InChI | InChI=1S/C25H22N4.H3N/c1-2-3-4-5-17-12-24-15-22-9-8-20(27-22)13-18-6-7-19(26-18)14-21-10-11-23(28-21)16-25(17)29-24;/h6-16H,2-5H2,1H3;1H3/b18-13-,19-14-,20-13-,21-14-,22-15-,23-16-,24-15-,25-16-; |
| InChIKey | AGHUBLMFIWYXRY-PTCLDXEGSA-N |
| XLogP | 5.69 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze azane;2-pentylporphyrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-pentylporphyrin?
The IUPAC name of azane;2-pentylporphyrin (CID 175279490) is azane;2-pentylporphyrin.
What is the SMILES notation for azane;2-pentylporphyrin?
The canonical SMILES for azane;2-pentylporphyrin is CCCCCC1=CC2=N/C1=C\C1=N/C(=C\C3=N/C(=C\C4=N/C(=C\2)C=C4)C=C3)C=C1.N.
What is the InChIKey of azane;2-pentylporphyrin?
The InChIKey is AGHUBLMFIWYXRY-PTCLDXEGSA-N. The full InChI is InChI=1S/C25H22N4.H3N/c1-2-3-4-5-17-12-24-15-22-9-8-20(27-22)13-18-6-7-19(26-18)14-21-10-11-23(28-21)16-25(17)29-24;/h6-16H,2-5H2,1H3;1H3/b18-13-,19-14-,20-13-,21-14-,22-15-,23-16-,24-15-,25-16-;.
What are the key properties of azane;2-pentylporphyrin?
azane;2-pentylporphyrin has a molecular weight of 395.51 g/mol, XLogP of 5.69, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-pentylporphyrin is sourced from PubChem (CID 175279490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).