C31H24N7O2S+ — CID 175281337
[4-[6-(1,3-benzothiazol-2-yl)-1H-benzimidazol-2-yl]benzoyl]imino-(4-morpholin-4-ylphenyl)iminoazanium (PubChem CID 175281337) has the molecular formula C31H24N7O2S+ and a molecular weight of 558.65 g/mol. Its IUPAC name is [4-[6-(1,3-benzothiazol-2-yl)-1H-benzimidazol-2-yl]benzoyl]imino-(4-morpholin-4-ylphenyl)iminoazanium.
| Compound Name | [4-[6-(1,3-benzothiazol-2-yl)-1H-benzimidazol-2-yl]benzoyl]imino-(4-morpholin-4-ylphenyl)iminoazanium |
|---|---|
| PubChem CID | 175281337 |
| Molecular Formula | C31H24N7O2S+ |
| Molecular Weight | 558.65 g/mol |
| Exact Mass | 558.17 |
| IUPAC Name | [4-[6-(1,3-benzothiazol-2-yl)-1H-benzimidazol-2-yl]benzoyl]imino-(4-morpholin-4-ylphenyl)iminoazanium |
| SMILES | O=C(N=[N+]=Nc1ccc(N2CCOCC2)cc1)c1ccc(-c2nc3ccc(-c4nc5ccccc5s4)cc3[nH]2)cc1 |
| InChI | InChI=1S/C31H23N7O2S/c39-30(36-37-35-23-10-12-24(13-11-23)38-15-17-40-18-16-38)21-7-5-20(6-8-21)29-32-25-14-9-22(19-27(25)33-29)31-34-26-3-1-2-4-28(26)41-31/h1-14,19H,15-18H2/p+1 |
| InChIKey | GEDWDVXZITVKFH-UHFFFAOYSA-O |
| XLogP | 6.79 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.65 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|