About propoxysilane;trioctylphosphane
propoxysilane;trioctylphosphane (PubChem CID 175291717) has the molecular formula C27H61OPSi
and a molecular weight of 460.84 g/mol. Its IUPAC name is propoxysilane;trioctylphosphane.
Molecular Properties
| Compound Name | propoxysilane;trioctylphosphane |
| PubChem CID | 175291717 |
| Molecular Formula | C27H61OPSi |
| Molecular Weight | 460.84 g/mol |
| Exact Mass | 460.42 |
| IUPAC Name | propoxysilane;trioctylphosphane |
| SMILES | CCCCCCCCP(CCCCCCCC)CCCCCCCC.CCCO[SiH3] |
| InChI | InChI=1S/C24H51P.C3H10OSi/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;1-2-3-4-5/h4-24H2,1-3H3;2-3H2,1,5H3 |
| InChIKey | CHFKGDPQYAMBOG-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.84 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze propoxysilane;trioctylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propoxysilane;trioctylphosphane?
The IUPAC name of propoxysilane;trioctylphosphane (CID 175291717) is propoxysilane;trioctylphosphane.
What is the SMILES notation for propoxysilane;trioctylphosphane?
The canonical SMILES for propoxysilane;trioctylphosphane is CCCCCCCCP(CCCCCCCC)CCCCCCCC.CCCO[SiH3].
What is the InChIKey of propoxysilane;trioctylphosphane?
The InChIKey is CHFKGDPQYAMBOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H51P.C3H10OSi/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;1-2-3-4-5/h4-24H2,1-3H3;2-3H2,1,5H3.
What are the key properties of propoxysilane;trioctylphosphane?
propoxysilane;trioctylphosphane has a molecular weight of 460.84 g/mol, XLogP of 9.24, 23 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propoxysilane;trioctylphosphane is sourced from PubChem (CID 175291717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).