C10H7FN2O2 — CID 175292798
4-[fluoro(phenyl)methylidene]pyrazolidine-3,5-dione (PubChem CID 175292798) has the molecular formula C10H7FN2O2 and a molecular weight of 206.18 g/mol. Its IUPAC name is 4-[fluoro(phenyl)methylidene]pyrazolidine-3,5-dione.
| Compound Name | 4-[fluoro(phenyl)methylidene]pyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 175292798 |
| Molecular Formula | C10H7FN2O2 |
| Molecular Weight | 206.18 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 4-[fluoro(phenyl)methylidene]pyrazolidine-3,5-dione |
| SMILES | O=C1NNC(=O)C1=C(F)c1ccccc1 |
| InChI | InChI=1S/C10H7FN2O2/c11-8(6-4-2-1-3-5-6)7-9(14)12-13-10(7)15/h1-5H,(H,12,14)(H,13,15) |
| InChIKey | VBGTVVNYNOEOQO-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.18 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|