C18H12N4O2S — CID 175293504
3-[4-[2-(1,3-thiazol-2-yl)phenyl]phenyl]triazole-4-carboxylic acid (PubChem CID 175293504) has the molecular formula C18H12N4O2S and a molecular weight of 348.39 g/mol. Its IUPAC name is 3-[4-[2-(1,3-thiazol-2-yl)phenyl]phenyl]triazole-4-carboxylic acid.
| Compound Name | 3-[4-[2-(1,3-thiazol-2-yl)phenyl]phenyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 175293504 |
| Molecular Formula | C18H12N4O2S |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 3-[4-[2-(1,3-thiazol-2-yl)phenyl]phenyl]triazole-4-carboxylic acid |
| SMILES | O=C(O)c1cnnn1-c1ccc(-c2ccccc2-c2nccs2)cc1 |
| InChI | InChI=1S/C18H12N4O2S/c23-18(24)16-11-20-21-22(16)13-7-5-12(6-8-13)14-3-1-2-4-15(14)17-19-9-10-25-17/h1-11H,(H,23,24) |
| InChIKey | VNLOCNWQGLSMAS-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |