C17H24N2O2S — CID 175297921
isocyanatosulfanylimino(oxo)methane;1,3,5-tri(propan-2-yl)benzene (PubChem CID 175297921) has the molecular formula C17H24N2O2S and a molecular weight of 320.46 g/mol. Its IUPAC name is isocyanatosulfanylimino(oxo)methane;1,3,5-tri(propan-2-yl)benzene.
| Compound Name | isocyanatosulfanylimino(oxo)methane;1,3,5-tri(propan-2-yl)benzene |
|---|---|
| PubChem CID | 175297921 |
| Molecular Formula | C17H24N2O2S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | isocyanatosulfanylimino(oxo)methane;1,3,5-tri(propan-2-yl)benzene |
| SMILES | CC(C)c1cc(C(C)C)cc(C(C)C)c1.O=C=NSN=C=O |
| InChI | InChI=1S/C15H24.C2N2O2S/c1-10(2)13-7-14(11(3)4)9-15(8-13)12(5)6;5-1-3-7-4-2-6/h7-12H,1-6H3; |
| InChIKey | BYWBNFGHZXZPRB-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|