C45H59N7O6 — CID 175298519
4-[[1-[8-[4-[[3-[[2-(dimethylamino)phenyl]methylamino]propylamino]methyl]phenoxy]octanoyl]piperidin-4-yl]amino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 175298519) has the molecular formula C45H59N7O6 and a molecular weight of 794.01 g/mol. Its IUPAC name is 4-[[1-[8-[4-[[3-[[2-(dimethylamino)phenyl]methylamino]propylamino]methyl]phenoxy]octanoyl]piperidin-4-yl]amino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[[1-[8-[4-[[3-[[2-(dimethylamino)phenyl]methylamino]propylamino]methyl]phenoxy]octanoyl]piperidin-4-yl]amino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 175298519 |
| Molecular Formula | C45H59N7O6 |
| Molecular Weight | 794.01 g/mol |
| Exact Mass | 793.45 |
| IUPAC Name | 4-[[1-[8-[4-[[3-[[2-(dimethylamino)phenyl]methylamino]propylamino]methyl]phenoxy]octanoyl]piperidin-4-yl]amino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | CN(C)c1ccccc1CNCCCNCc1ccc(OCCCCCCCC(=O)N2CCC(Nc3cccc4c3C(=O)N(C3CCC(=O)NC3=O)C4=O)CC2)cc1 |
| InChI | InChI=1S/C45H59N7O6/c1-50(2)38-15-8-7-12-33(38)31-47-26-11-25-46-30-32-17-19-35(20-18-32)58-29-9-5-3-4-6-16-41(54)51-27-23-34(24-28-51)48-37-14-10-13-36-42(37)45(57)52(44(36)56)39-21-22-40(53)49-43(39)55/h7-8,10,12-15,17-20,34,39,46-48H,3-6,9,11,16,21-31H2,1-2H3,(H,49,53,55) |
| InChIKey | BYZKNKXIRDAWJO-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 152.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.01 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|