C12H26N2O2 — CID 175301639
N-hydroxy-N,3,3-trimethyl-2-(pentylamino)butanamide (PubChem CID 175301639) has the molecular formula C12H26N2O2 and a molecular weight of 230.35 g/mol. Its IUPAC name is N-hydroxy-N,3,3-trimethyl-2-(pentylamino)butanamide.
| Compound Name | N-hydroxy-N,3,3-trimethyl-2-(pentylamino)butanamide |
|---|---|
| PubChem CID | 175301639 |
| Molecular Formula | C12H26N2O2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | N-hydroxy-N,3,3-trimethyl-2-(pentylamino)butanamide |
| SMILES | CCCCCNC(C(=O)N(C)O)C(C)(C)C |
| InChI | InChI=1S/C12H26N2O2/c1-6-7-8-9-13-10(12(2,3)4)11(15)14(5)16/h10,13,16H,6-9H2,1-5H3 |
| InChIKey | WYNDJDBNPWBYQJ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|