C11H11F11N2O3 — CID 175304120
N'-(4,4,5,5,6,6,7,7,8,8,8-undecafluoro-2-hydroxyoctyl)propanediamide (PubChem CID 175304120) has the molecular formula C11H11F11N2O3 and a molecular weight of 428.20 g/mol. Its IUPAC name is N'-(4,4,5,5,6,6,7,7,8,8,8-undecafluoro-2-hydroxyoctyl)propanediamide.
| Compound Name | N'-(4,4,5,5,6,6,7,7,8,8,8-undecafluoro-2-hydroxyoctyl)propanediamide |
|---|---|
| PubChem CID | 175304120 |
| Molecular Formula | C11H11F11N2O3 |
| Molecular Weight | 428.20 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | N'-(4,4,5,5,6,6,7,7,8,8,8-undecafluoro-2-hydroxyoctyl)propanediamide |
| SMILES | NC(=O)CC(=O)NCC(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H11F11N2O3/c12-7(13,2-4(25)3-24-6(27)1-5(23)26)8(14,15)9(16,17)10(18,19)11(20,21)22/h4,25H,1-3H2,(H2,23,26)(H,24,27) |
| InChIKey | HAJQSWCVZMAEHT-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.20 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|