C14H16F13NO3 — CID 66573960
N-[(2S,3R)-7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluoro-1,3-dihydroxydodecan-2-yl]acetamide (PubChem CID 66573960) has the molecular formula C14H16F13NO3 and a molecular weight of 493.26 g/mol. Its IUPAC name is N-[(2S,3R)-7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluoro-1,3-dihydroxydodecan-2-yl]acetamide.
| Compound Name | N-[(2S,3R)-7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluoro-1,3-dihydroxydodecan-2-yl]acetamide |
|---|---|
| PubChem CID | 66573960 |
| Molecular Formula | C14H16F13NO3 |
| Molecular Weight | 493.26 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | N-[(2S,3R)-7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluoro-1,3-dihydroxydodecan-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H](CO)[C@H](O)CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H16F13NO3/c1-6(30)28-7(5-29)8(31)3-2-4-9(15,16)10(17,18)11(19,20)12(21,22)13(23,24)14(25,26)27/h7-8,29,31H,2-5H2,1H3,(H,28,30)/t7-,8+/m0/s1 |
| InChIKey | REFCYPVTPJMAGL-JGVFFNPUSA-N |
| XLogP | 3.75 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.26 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|