C10H11FN2O4S — CID 175312517
4-[1-(fluoromethyl)cyclopropyl]-3-nitrobenzenesulfonamide (PubChem CID 175312517) has the molecular formula C10H11FN2O4S and a molecular weight of 274.27 g/mol. Its IUPAC name is 4-[1-(fluoromethyl)cyclopropyl]-3-nitrobenzenesulfonamide.
| Compound Name | 4-[1-(fluoromethyl)cyclopropyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 175312517 |
| Molecular Formula | C10H11FN2O4S |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 4-[1-(fluoromethyl)cyclopropyl]-3-nitrobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(C2(CF)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H11FN2O4S/c11-6-10(3-4-10)8-2-1-7(18(12,16)17)5-9(8)13(14)15/h1-2,5H,3-4,6H2,(H2,12,16,17) |
| InChIKey | YWYXCYGSNRDBQC-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|